EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O4 |
| Net Charge | 0 |
| Average Mass | 432.645 |
| Monoisotopic Mass | 432.32396 |
| SMILES | [H][C@]1([C@]([H])(C)CCCC(C)C)CC[C@@]2([H])/C(=C/[C@@]3([H])OOCC4=C3C[C@@H](O)C[C@@H]4O)CCC[C@]12C |
| InChI | InChI=1S/C27H44O4/c1-17(2)7-5-8-18(3)23-10-11-24-19(9-6-12-27(23,24)4)13-26-21-14-20(28)15-25(29)22(21)16-30-31-26/h13,17-18,20,23-26,28-29H,5-12,14-16H2,1-4H3/b19-13+/t18-,20-,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | JHRNDQFGELFISF-YHQHOCHFSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (7E)-(1S,3R,6R)-6,19-epidioxy-9,10-seco-5(10),7-cholestadiene-1,3-diol (CHEBI:137141) is a vitamin D (CHEBI:27300) |
| Synonyms | Source |
|---|---|
| (6R)-6,19-epidioxy-1aα-hydroxy-6,19-dihydrocholecalciferol | LIPID MAPS |
| (6R)-6,19-epidioxy-1α-hydroxy-6,19-dihydrovitamin D3 | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST03020277 | LIPID MAPS |