EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44 |
| Net Charge | 0 |
| Average Mass | 368.649 |
| Monoisotopic Mass | 368.34430 |
| SMILES | [H][C@]1([C@]([H])(C)CCCC(C)C)CC[C@@]2([H])/C(=C/C=C3/CCCCC3=C)CCC[C@]12C |
| InChI | InChI=1S/C27H44/c1-20(2)10-8-12-22(4)25-17-18-26-24(14-9-19-27(25,26)5)16-15-23-13-7-6-11-21(23)3/h15-16,20,22,25-26H,3,6-14,17-19H2,1-2,4-5H3/b23-15-,24-16+/t22-,25-,26+,27-/m1/s1 |
| InChIKey | FXKMDILIEQILCA-VDVRBEGSSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z,7E)-9,10-seco-5,7,10(19)-cholestatriene (CHEBI:137139) is a vitamin D (CHEBI:27300) |
| Synonym | Source |
|---|---|
| 3-Deoxyvitamin D3 | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST03020618 | LIPID MAPS |