EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H45NO3 |
| Net Charge | 0 |
| Average Mass | 455.683 |
| Monoisotopic Mass | 455.33994 |
| SMILES | [H][C@]1([C@@]([H])(C)CCC(=O)N2CCCCC2)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](O)C[C@H](O)C3=C)CCC[C@]12C |
| InChI | InChI=1S/C29H45NO3/c1-20(9-14-28(33)30-16-5-4-6-17-30)25-12-13-26-22(8-7-15-29(25,26)3)10-11-23-18-24(31)19-27(32)21(23)2/h10-11,20,24-27,31-32H,2,4-9,12-19H2,1,3H3/b22-10+,23-11-/t20-,24+,25+,26-,27-,29+/m0/s1 |
| InChIKey | DXWZPQRKPXFQGC-QCUPEZPBSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ecalcidene (CHEBI:137136) is a vitamin D (CHEBI:27300) |
| Synonym | Source |
|---|---|
| (5Z,7E)-(1S,3R)-24-oxo-25-aza-26,27-propano-9,10-seco-5,7,10(19)-cholestatriene-1,3,25-triol | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST03020681 | LIPID MAPS |