EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O3 |
| Net Charge | 0 |
| Average Mass | 414.630 |
| Monoisotopic Mass | 414.31340 |
| SMILES | [H][C@]1([C@]([H])(C)C(=O)CCC(C)C)CC[C@@]2([H])/C(=C/C=C3/C[C@@H](O)C[C@H](O)C3=C)CCC[C@]12C |
| InChI | InChI=1S/C27H42O3/c1-17(2)8-13-25(29)19(4)23-11-12-24-20(7-6-14-27(23,24)5)9-10-21-15-22(28)16-26(30)18(21)3/h9-10,17,19,22-24,26,28,30H,3,6-8,11-16H2,1-2,4-5H3/b20-9+,21-10-/t19-,22+,23+,24-,26-,27+/m0/s1 |
| InChIKey | DXWGTJMCYINGNZ-IQSZEILRSA-N |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (5Z,7E)-(1S,3R)-1,3-dihydroxy-9,10-seco-5,7,10(19)-cholestatrien-22-one (CHEBI:137134) is a vitamin D (CHEBI:27300) |
| Synonyms | Source |
|---|---|
| 1α-hydroxy-22-oxocholecalciferol | LIPID MAPS |
| 1α-hydroxy-22-oxovitamin D3 | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMST03020159 | LIPID MAPS |