EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O3 |
| Net Charge | 0 |
| Average Mass | 294.435 |
| Monoisotopic Mass | 294.21949 |
| SMILES | CC/C=C\C[C@@H]1C(=O)CC[C@@H]1CCCCCCCC(=O)O |
| InChI | InChI=1S/C18H30O3/c1-2-3-7-11-16-15(13-14-17(16)19)10-8-5-4-6-9-12-18(20)21/h3,7,15-16H,2,4-6,8-14H2,1H3,(H,20,21)/b7-3-/t15-,16-/m0/s1 |
| InChIKey | BZXZFDKIRZBJEP-JMTMCXQRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Zea mays (ncbitaxon:4577) | - | PubMed (16663643) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 8-[(1S,2S)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoic acid (CHEBI:137132) has role plant metabolite (CHEBI:76924) |
| 8-[(1S,2S)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoic acid (CHEBI:137132) is a 8-{3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}octanoic acid (CHEBI:191853) |
| 8-[(1S,2S)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoic acid (CHEBI:137132) is conjugate acid of 8-[(1S,2S)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoate (CHEBI:191855) |
| Incoming Relation(s) |
| 8-[(1S,2S)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoate (CHEBI:191855) is conjugate base of 8-[(1S,2S)-3-oxo-2-{(Z)-pent-2-en-1-yl}cyclopentyl]octanoic acid (CHEBI:137132) |
| IUPAC Name |
|---|
| 8-{(1S,2S)-3-oxo-2-[(2Z)-pent-2-en-1-yl]cyclopentyl}octanoic acid |
| Synonyms | Source |
|---|---|
| (9S,13S)-10,11-dihydro-12-oxo-15-phytoenoic acid | LIPID MAPS |
| (1S,2S)-3-oxo-2-(2'Z-pentenyl)-cyclopentaneoctanoic acid | LIPID MAPS |
| 8-[(1S,2S)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoic acid | KEGG COMPOUND |
| (1S,2S)-OPC8 | ChEBI |
| OPC-8:0 | KEGG COMPOUND |
| (1S,2S)-3-oxo-2-(2Z)-2-pentenyl-cyclopentaneoctanoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA02010007 | LIPID MAPS |
| C00000366 | KNApSAcK |
| C04780 | KEGG COMPOUND |
| FDB001433 | FooDB |
| Registry Numbers | Sources |
|---|---|
| CAS:204135-86-4 | KNApSAcK |
| Citations |
|---|