EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O9 |
| Net Charge | 0 |
| Average Mass | 536.662 |
| Monoisotopic Mass | 536.29853 |
| SMILES | C[C@H]1O[C@@H](O[C@H]2CC[C@]3(CO)C4CC[C@]5(C)C(C6=CC(=O)OC6)CC[C@]5(O)C4CC[C@]3(O)C2)C[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C29H44O9/c1-16-25(33)22(31)12-24(37-16)38-18-3-8-27(15-30)20-4-7-26(2)19(17-11-23(32)36-14-17)6-10-29(26,35)21(20)5-9-28(27,34)13-18/h11,16,18-22,24-25,30-31,33-35H,3-10,12-15H2,1-2H3/t16-,18+,19?,20?,21?,22+,24+,25-,26-,27+,28+,29+/m1/s1 |
| InChIKey | KISYRRMFQYIIFQ-PQLBFUHRSA-N |
| Roles Classification |
|---|
| Application: | cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Helveticosol (CHEBI:137099) is a cardenolide glycoside (CHEBI:38092) |
| Manual Xrefs | Databases |
|---|---|
| 4476648 | ChemSpider |