EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H30FN3O7 |
| Net Charge | 0 |
| Average Mass | 467.494 |
| Monoisotopic Mass | 467.20678 |
| SMILES | COC(=O)C[C@H](NC(=O)[C@H](C)NC(=O)[C@@H](NC(=O)OCc1ccccc1)C(C)C)C(=O)CF |
| InChI | InChI=1S/C22H30FN3O7/c1-13(2)19(26-22(31)33-12-15-8-6-5-7-9-15)21(30)24-14(3)20(29)25-16(17(27)11-23)10-18(28)32-4/h5-9,13-14,16,19H,10-12H2,1-4H3,(H,24,30)(H,25,29)(H,26,31)/t14-,16-,19-/m0/s1 |
| InChIKey | MIFGOLAMNLSLGH-QOKNQOGYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). apoptosis inhibitor Any substance that inhibits the process of apoptosis (programmed cell death) in multi-celled organisms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Z-Val-Ala-Asp(OMe)-CH2F (CHEBI:137045) has role apoptosis inhibitor (CHEBI:68494) |
| Z-Val-Ala-Asp(OMe)-CH2F (CHEBI:137045) has role protease inhibitor (CHEBI:37670) |
| Z-Val-Ala-Asp(OMe)-CH2F (CHEBI:137045) is a carbamate ester (CHEBI:23003) |
| Z-Val-Ala-Asp(OMe)-CH2F (CHEBI:137045) is a organofluorine compound (CHEBI:37143) |
| Z-Val-Ala-Asp(OMe)-CH2F (CHEBI:137045) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| N-[(benzyloxy)carbonyl]-L-valyl-N-[(3S)-5-fluoro-1-methoxy-1,4-dioxopentan-3-yl]-L-alaninamide |
| Synonyms | Source |
|---|---|
| pan-caspase inhibitor | SUBMITTER |
| Z-Val-Ala-Asp(OMe)-FMK | ChEBI |
| Z-Val-Ala-Asp(OMe)-fluoromethyl ketone | ChEBI |
| Z-VAD(OMe)-FMK | ChEBI |
| Z-VAD-FMK | ChEBI |
| Z-L-Val-L-Ala-L-Asp(OMe)-CH2F | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8170381 | Reaxys |
| CAS:187389-52-2 | SUBMITTER |
| Citations |
|---|