EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O5 |
| Net Charge | 0 |
| Average Mass | 350.455 |
| Monoisotopic Mass | 350.20932 |
| SMILES | CC[C@H](O)/C=C/C=C\C[C@@H](O)/C=C/C=C/C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O5/c1-2-17(21)11-8-5-9-14-18(22)12-6-3-4-7-13-19(23)15-10-16-20(24)25/h3-9,11-13,17-19,21-23H,2,10,14-16H2,1H3,(H,24,25)/b4-3+,9-5-,11-8+,12-6+,13-7-/t17-,18-,19+/m0/s1 |
| InChIKey | AOPOCGPBAIARAV-JJVMZPRHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (21206090) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (18S)-resolvin E1 (CHEBI:137038) has role anti-inflammatory agent (CHEBI:67079) |
| (18S)-resolvin E1 (CHEBI:137038) has role human xenobiotic metabolite (CHEBI:76967) |
| (18S)-resolvin E1 (CHEBI:137038) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| (18S)-resolvin E1 (CHEBI:137038) is a resolvin (CHEBI:132120) |
| (18S)-resolvin E1 (CHEBI:137038) is a secondary allylic alcohol (CHEBI:134396) |
| (18S)-resolvin E1 (CHEBI:137038) is a triol (CHEBI:27136) |
| (18S)-resolvin E1 (CHEBI:137038) is conjugate acid of (18S)-resolvin E1(1−) (CHEBI:136057) |
| Incoming Relation(s) |
| (18S)-resolvin E1(1−) (CHEBI:136057) is conjugate base of (18S)-resolvin E1 (CHEBI:137038) |
| IUPAC Name |
|---|
| (5S,6Z,8E,10E,12R,14Z,16E,18S)-5,12,18-trihydroxyicosa-6,8,10,14,16-pentaenoic acid |
| Synonyms | Source |
|---|---|
| 18S-resolvin E1 | ChEBI |
| 18S-RvE1 | ChEBI |
| (5S,12R,18S)-trihydroxy-(6Z,8E,10E,14Z,16E)-eicosapentaenoic acid | ChEBI |
| (5S,12R,18S)-trihydroxy-(6Z,8E,10E,14Z,16E)-icosapentaenoic acid | ChEBI |
| (5S,6Z,8E,10E,12R,14Z,16E,18S)-5,12,18-trihydroxyicosapentaenoic acid | ChEBI |
| 5S,12R,18S-trihydroxy-6Z,8E,10E,14Z,16E-eicosapentaenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070035 | LIPID MAPS |
| Citations |
|---|