EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H30O4 |
| Net Charge | 0 |
| Average Mass | 334.456 |
| Monoisotopic Mass | 334.21441 |
| SMILES | CC[C@H](O)/C=C/C=C\C/C=C\C/C=C\C=C\[C@@H](O)CCCC(=O)O |
| InChI | InChI=1S/C20H30O4/c1-2-18(21)14-11-9-7-5-3-4-6-8-10-12-15-19(22)16-13-17-20(23)24/h3-4,7-12,14-15,18-19,21-22H,2,5-6,13,16-17H2,1H3,(H,23,24)/b4-3-,9-7-,10-8-,14-11+,15-12+/t18-,19+/m0/s1 |
| InChIKey | KPRHYAOSTOHNQA-SFHVADPASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (21206090) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (18S)-resolvin E2 (CHEBI:137034) has role anti-inflammatory agent (CHEBI:67079) |
| (18S)-resolvin E2 (CHEBI:137034) has role human xenobiotic metabolite (CHEBI:76967) |
| (18S)-resolvin E2 (CHEBI:137034) is a diol (CHEBI:23824) |
| (18S)-resolvin E2 (CHEBI:137034) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| (18S)-resolvin E2 (CHEBI:137034) is a resolvin (CHEBI:132120) |
| (18S)-resolvin E2 (CHEBI:137034) is a secondary allylic alcohol (CHEBI:134396) |
| (18S)-resolvin E2 (CHEBI:137034) is conjugate acid of (18S)-resolvin E2(1−) (CHEBI:136056) |
| Incoming Relation(s) |
| (18S)-resolvin E2(1−) (CHEBI:136056) is conjugate base of (18S)-resolvin E2 (CHEBI:137034) |
| IUPAC Name |
|---|
| (5S,6E,8Z,11Z,14Z,16E,18S)-5,18-dihydroxyicosa-6,8,11,14,16-pentaenoic acid |
| Synonyms | Source |
|---|---|
| 18S-resolvin E2 | ChEBI |
| 18S-RvE2 | ChEBI |
| (5S,18S)-dihydroxy-(6E,8Z,11Z,14Z,16E)-eicosapentaenoic acid | ChEBI |
| (5S,18S)-dihydroxy-(6E,8Z,11Z,14Z,16E)-icosapentaenoic acid | ChEBI |
| (5S,6E,8Z,11Z,14Z,16E,18S)-5,18-dihydroxyicosapentaenoic acid | ChEBI |
| 5S,18S-dihydroxy-6E,8Z,11Z,14Z,16E-eicosapentaenoic acid | LIPID MAPS |
| Manual Xrefs | Databases |
|---|---|
| LMFA03070036 | LIPID MAPS |
| Citations |
|---|