EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H19NO3S |
| Net Charge | 0 |
| Average Mass | 221.322 |
| Monoisotopic Mass | 221.10856 |
| SMILES | CSCCCCCC[C@H](NO)C(=O)O |
| InChI | InChI=1S/C9H19NO3S/c1-14-7-5-3-2-4-6-8(10-13)9(11)12/h8,10,13H,2-7H2,1H3,(H,11,12)/t8-/m0/s1 |
| InChIKey | CGCGAIDHWUSRHO-QMMMGPOBSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-hydroxy-L-tetrahomomethionine (CHEBI:137024) is a N-hydroxy-L-polyhomomethionine (CHEBI:137006) |
| N-hydroxy-L-tetrahomomethionine (CHEBI:137024) is a N-hydroxytetrahomomethionine (CHEBI:50762) |
| N-hydroxy-L-tetrahomomethionine (CHEBI:137024) is conjugate acid of N-hydroxy-L-tetrahomomethioninate (CHEBI:134668) |
| Incoming Relation(s) |
| N-hydroxy-L-tetrahomomethioninate (CHEBI:134668) is conjugate base of N-hydroxy-L-tetrahomomethionine (CHEBI:137024) |
| IUPAC Name |
|---|
| (2S)-2-(hydroxyamino)-8-(methylsulfanyl)octanoic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-14051 | MetaCyc |