EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O5 |
| Net Charge | 0 |
| Average Mass | 378.509 |
| Monoisotopic Mass | 378.24062 |
| SMILES | CC/C=C\C/C=C\C=C\C(O)C(O)/C=C/C=C\C(O)CCCCCC(=O)O |
| InChI | InChI=1S/C22H34O5/c1-2-3-4-5-6-7-10-16-20(24)21(25)17-13-12-15-19(23)14-9-8-11-18-22(26)27/h3-4,6-7,10,12-13,15-17,19-21,23-25H,2,5,8-9,11,14,18H2,1H3,(H,26,27)/b4-3-,7-6-,15-12-,16-10+,17-13+ |
| InChIKey | XFIHWRRFJFILNC-FFAJSMOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (27704804) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (27704804) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin T2 (CHEBI:137018) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin T2 (CHEBI:137018) has role human xenobiotic metabolite (CHEBI:76967) |
| resolvin T2 (CHEBI:137018) has role mouse metabolite (CHEBI:75771) |
| resolvin T2 (CHEBI:137018) is a docosanoid (CHEBI:131863) |
| resolvin T2 (CHEBI:137018) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin T2 (CHEBI:137018) is a resolvin (CHEBI:132120) |
| resolvin T2 (CHEBI:137018) is conjugate acid of resolvin T2(1−) (CHEBI:134657) |
| Incoming Relation(s) |
| resolvin T2(1−) (CHEBI:134657) is conjugate base of resolvin T2 (CHEBI:137018) |
| IUPAC Name |
|---|
| (8Z,10E,14E,16Z,19Z)-7,12,13-trihydroxydocosa-8,10,14,16,19-pentaenoic acid |
| Synonyms | Source |
|---|---|
| 13-series resolvin 2 | ChEBI |
| (8Z,10E,14E,16Z,19Z)-7,12,13-trihydroxydocosapentaenoic acid | ChEBI |
| RvT2 | ChEBI |
| Citations |
|---|