EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H11NO3 |
| Net Charge | 0 |
| Average Mass | 181.191 |
| Monoisotopic Mass | 181.07389 |
| SMILES | O=C(O)C(CO)Nc1ccccc1 |
| InChI | InChI=1S/C9H11NO3/c11-6-8(9(12)13)10-7-4-2-1-3-5-7/h1-5,8,10-11H,6H2,(H,12,13) |
| InChIKey | CXIYBDIJKQJUMN-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-phenylserine (CHEBI:137012) is a non-proteinogenic α-amino acid (CHEBI:83925) |
| Manual Xrefs | Databases |
|---|---|
| 195060 | ChemSpider |