EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34O5 |
| Net Charge | 0 |
| Average Mass | 378.509 |
| Monoisotopic Mass | 378.24062 |
| SMILES | CCC(O)/C=C/C=C\C=C\C(O)C/C=C\C=C\C(O)CCCCCC(=O)O |
| InChI | InChI=1S/C22H34O5/c1-2-19(23)13-7-3-4-8-14-20(24)15-9-5-10-16-21(25)17-11-6-12-18-22(26)27/h3-5,7-10,13-14,16,19-21,23-25H,2,6,11-12,15,17-18H2,1H3,(H,26,27)/b4-3-,9-5-,13-7+,14-8+,16-10+ |
| InChIKey | GGPSRSCVYRYOSY-PJPPRHTRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (27704804) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (27704804) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. specialised pro-resolving mediator A class of cell signaling molecules enzymatically derived from n-3 long chain polyunsaturated fatty acids that have important roles in orchestrating the resolution of tissue inflammation. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| resolvin T1 (CHEBI:137011) has role anti-inflammatory agent (CHEBI:67079) |
| resolvin T1 (CHEBI:137011) has role human xenobiotic metabolite (CHEBI:76967) |
| resolvin T1 (CHEBI:137011) has role mouse metabolite (CHEBI:75771) |
| resolvin T1 (CHEBI:137011) is a docosanoid (CHEBI:131863) |
| resolvin T1 (CHEBI:137011) is a hydroxy polyunsaturated fatty acid (CHEBI:140345) |
| resolvin T1 (CHEBI:137011) is a resolvin (CHEBI:132120) |
| resolvin T1 (CHEBI:137011) is conjugate acid of resolvin T1(1−) (CHEBI:134656) |
| Incoming Relation(s) |
| resolvin T1(1−) (CHEBI:134656) is conjugate base of resolvin T1 (CHEBI:137011) |
| IUPAC Name |
|---|
| (8E,10Z,14E,16Z,18E)-7,13,20-trihydroxydocosa-8,10,14,16,18-pentaenoic acid |
| Synonyms | Source |
|---|---|
| (8E,10Z,14E,16Z,18E)-7,13,20-trihydroxydocosapentaenoic acid | ChEBI |
| RvT1 | ChEBI |
| Citations |
|---|