EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (CH2)n.C5H11NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | CSCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-10-4-2-3-5(7)6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | SFSJZXMDTNDWIX-YFKPBYRVSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-polyhomomethionine (CHEBI:136997) is a methyl sulfide (CHEBI:86315) |
| L-polyhomomethionine (CHEBI:136997) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-polyhomomethionine (CHEBI:136997) is a sulfur-containing amino acid (CHEBI:26834) |
| L-polyhomomethionine (CHEBI:136997) is tautomer of L-polyhomomethionine zwitterion (CHEBI:134631) |
| Incoming Relation(s) |
| L-dihomomethionine (CHEBI:136998) is a L-polyhomomethionine (CHEBI:136997) |
| L-hexahomomethionine (CHEBI:137005) is a L-polyhomomethionine (CHEBI:136997) |
| L-pentahomomethionine (CHEBI:137004) is a L-polyhomomethionine (CHEBI:136997) |
| L-tetrahomomethionine (CHEBI:137002) is a L-polyhomomethionine (CHEBI:136997) |
| L-trihomomethionine (CHEBI:136999) is a L-polyhomomethionine (CHEBI:136997) |
| L-polyhomomethionine zwitterion (CHEBI:134631) is tautomer of L-polyhomomethionine (CHEBI:136997) |
| Synonyms | Source |
|---|---|
| methionine homolog | ChEBI |
| methionine homologs | ChEBI |
| methionine homologue | ChEBI |
| methionine homologues | ChEBI |
| L-polyhomomethionines | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| N-homo-methionine | MetaCyc |