EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H21N3O8S |
| Net Charge | 0 |
| Average Mass | 415.424 |
| Monoisotopic Mass | 415.10494 |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSc1cc(O)ccc1O)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H21N3O8S/c17-9(16(26)27)2-4-13(22)19-10(15(25)18-6-14(23)24)7-28-12-5-8(20)1-3-11(12)21/h1,3,5,9-10,20-21H,2,4,6-7,17H2,(H,18,25)(H,19,22)(H,23,24)(H,26,27)/t9-,10-/m0/s1 |
| InChIKey | PBSYQNUIZQXWAE-UWVGGRQHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | - | PubMed (10996661) |
| Roles Classification |
|---|
| Biological Roles: | human xenobiotic metabolite Any human metabolite produced by metabolism of a xenobiotic compound in humans. nephrotoxic agent A role played by any chemical compound (natural or synthetic) exhibiting itself through the ability to induce damage to the kidneys. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(glutathion-S-yl)-1,4-hydroquinone (CHEBI:136994) has role human xenobiotic metabolite (CHEBI:76967) |
| 2-(glutathion-S-yl)-1,4-hydroquinone (CHEBI:136994) has role nephrotoxic agent (CHEBI:50909) |
| 2-(glutathion-S-yl)-1,4-hydroquinone (CHEBI:136994) is a aryl sulfide (CHEBI:35683) |
| 2-(glutathion-S-yl)-1,4-hydroquinone (CHEBI:136994) is a glutathione conjugate (CHEBI:24335) |
| 2-(glutathion-S-yl)-1,4-hydroquinone (CHEBI:136994) is a hydroquinones (CHEBI:24646) |
| 2-(glutathion-S-yl)-1,4-hydroquinone (CHEBI:136994) is conjugate acid of 2-(glutathion-S-yl)-1,4-hydroquinone(1−) (CHEBI:134616) |
| Incoming Relation(s) |
| 2-(glutathion-S-yl)-1,4-hydroquinone(1−) (CHEBI:134616) is conjugate base of 2-(glutathion-S-yl)-1,4-hydroquinone (CHEBI:136994) |
| IUPAC Name |
|---|
| L-γ-glutamyl-S-(2,5-dihydroxyphenyl)-L-cysteinylglycine |
| Synonyms | Source |
|---|---|
| S-(2,5-dihydroxyphenyl)glutathione | ChEBI |
| Glut-bsq conjugate | ChemIDplus |
| 2-(S-Glutathionyl)hydroquinone | ChemIDplus |
| Glutathionyl hydroquinone | ChemIDplus |
| HQ-SG | ChemIDplus |
| S-glutathionyl-p-hydroquinone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPD-19760 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8365785 | Reaxys |
| CAS:76726-99-3 | ChemIDplus |
| Citations |
|---|