EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H29O5S |
| Net Charge | -1 |
| Average Mass | 369.503 |
| Monoisotopic Mass | 369.17412 |
| SMILES | [H][C@@]12CC[C@]3([H])[C@]([H])(CC[C@]4(C)[C@@H](OS(=O)(=O)[O-])CC[C@@]34[H])[C@@]1(C)CCC(=O)C2 |
| InChI | InChI=1S/C19H30O5S/c1-18-9-7-13(20)11-12(18)3-4-14-15-5-6-17(24-25(21,22)23)19(15,2)10-8-16(14)18/h12,14-17H,3-11H2,1-2H3,(H,21,22,23)/p-1/t12-,14-,15-,16-,17-,18-,19-/m0/s1 |
| InChIKey | KYVPWJSGFKNNLD-ABEVXSGRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5α-dihydrotestosterone sulfate(1−) (CHEBI:136982) is a steroid sulfate oxoanion (CHEBI:59696) |
| 5α-dihydrotestosterone sulfate(1−) (CHEBI:136982) is conjugate base of 5α-dihydrotestosterone sulfate (CHEBI:138026) |
| Incoming Relation(s) |
| 5α-dihydrotestosterone sulfate (CHEBI:138026) is conjugate acid of 5α-dihydrotestosterone sulfate(1−) (CHEBI:136982) |
| IUPAC Name |
|---|
| 3-oxo-5α-androstan-17β-yl sulfate |
| Synonyms | Source |
|---|---|
| (5α,17β)-3-oxoandrostan-17-yl sulfate | IUPAC |
| 5α-dihydrotestosterone 17-sulfate | ChEBI |
| UniProt Name | Source |
|---|---|
| 5α-dihydrotestosterone sulfate | UniProt |
| Citations |
|---|