EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H29O9 |
| Net Charge | -1 |
| Average Mass | 461.487 |
| Monoisotopic Mass | 461.18171 |
| SMILES | [H][C@@]12CCC(=O)[C@@]1(C)CC[C@]1([H])c3cc(O)c(O[C@@H]4O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]4O)cc3CC[C@@]21[H] |
| InChI | InChI=1S/C24H30O9/c1-24-7-6-11-12(14(24)4-5-17(24)26)3-2-10-8-16(15(25)9-13(10)11)32-23-20(29)18(27)19(28)21(33-23)22(30)31/h8-9,11-12,14,18-21,23,25,27-29H,2-7H2,1H3,(H,30,31)/p-1/t11-,12+,14-,18-,19-,20+,21-,23+,24-/m0/s1 |
| InChIKey | OSGKEDCKMGOZOQ-FKYASPJISA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136967) is a monocarboxylic acid anion (CHEBI:35757) |
| 2-hydroxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136967) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| 2-hydroxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136967) is a β-D-glucosiduronate (CHEBI:83411) |
| 2-hydroxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136967) is conjugate base of 2-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137924) |
| Incoming Relation(s) |
| 2-hydroxyestrone 3-O-(β-D-glucuronide) (CHEBI:137924) is conjugate acid of 2-hydroxyestrone 3-O-(β-D-glucuronide)(1−) (CHEBI:136967) |
| IUPAC Name |
|---|
| 2-hydroxy-17-oxoestra-1,3,5(10)-trien-3-yl β-D-glucopyranosiduronate |
| Synonyms | Source |
|---|---|
| 2-hydroxyestrone 3-glucuronide(1−) | ChEBI |
| 2-hydroxyestrone 3-β-glucuronide(1−) | ChEBI |
| 2-hydroxyestrone 3-β-D-glucuronide(1−) | ChEBI |
| 2-OHE1 3G(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 2-hydroxyestrone 3-O-(β-D-glucuronate) | UniProt |
| Citations |
|---|