EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:136960 - ditrans,polycis-polyprenyl diphosphate(3−)
| Formula | (C5H8)n.C20H33O7P2 |
| Net Charge | -3 |
| Average Mass | 515.544 |
| Monoisotopic Mass | 515.23440 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C\CC/C(C)=C\COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C25H44O7P2/c1-21(2)11-7-12-22(3)13-8-14-23(4)15-9-16-24(5)17-10-18-25(6)19-20-31-34(29,30)32-33(26,27)28/h11,13,15,17,19H,7-10,12,14,16,18,20H2,1-6H3,(H,29,30)(H2,26,27,28)/p-3/b22-13+,23-15+,24-17-,25-19- |
| InChIKey | JMVSBFJBMXQNJW-PSTDWBAXSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ditrans,polycis-polyprenyl diphosphate(3−) (CHEBI:136960) has functional parent ditrans,polycis-polyprenol (CHEBI:67132) |
| ditrans,polycis-polyprenyl diphosphate(3−) (CHEBI:136960) is a organophosphate oxoanion (CHEBI:58945) |
| ditrans,polycis-polyprenyl diphosphate(3−) (CHEBI:136960) is a polyprenol diphosphate(3−) (CHEBI:167056) |
| ditrans,polycis-polyprenyl diphosphate(3−) (CHEBI:136960) is conjugate base of ditrans,polycis-polyprenyl diphosphate (CHEBI:27845) |
| Incoming Relation(s) |
| ditrans,polycis-undecaprenyl diphosphate(3−) (CHEBI:58405) is a ditrans,polycis-polyprenyl diphosphate(3−) (CHEBI:136960) |
| ditrans,polycis-polyprenyl diphosphate (CHEBI:27845) is conjugate acid of ditrans,polycis-polyprenyl diphosphate(3−) (CHEBI:136960) |
| IUPAC Name |
|---|
| α-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-yl]-ω-[(2Z)-2-methyl-4-{[(phosphonatooxy)phosphinato]oxy}but-2-en-1-yl]poly[(2Z)-2-methylbut-2-ene-1,4-diyl] |
| Synonyms | Source |
|---|---|
| dehydrodolichyl diphosphate(3−) | ChEBI |
| dehydrodolichol diphosphate(3−) | ChEBI |
| UniProt Name | Source |
|---|---|
| di-trans,poly-cis-polyprenyl diphosphate | UniProt |