EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H27NO10S3 |
| Net Charge | 0 |
| Average Mass | 465.568 |
| Monoisotopic Mass | 465.07971 |
| SMILES | CS(=O)CCCCCCC(=NOS(=O)(=O)O)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C14H27NO10S3/c1-27(20)7-5-3-2-4-6-10(15-25-28(21,22)23)26-14-13(19)12(18)11(17)9(8-16)24-14/h9,11-14,16-19H,2-8H2,1H3,(H,21,22,23)/t9-,11-,12+,13-,14+,27?/m1/s1 |
| InChIKey | OOGAQHVYHLPICD-DNDZILKHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS272) | ||
| - | PubMed (27656890) | ||
| Hesperis matronalis (ncbitaxon:264418) | - | Article (AGR:IND44562811) |
| Roles Classification |
|---|
| Biological Roles: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| glucohesperin (CHEBI:136956) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| glucohesperin (CHEBI:136956) is a ω-[(methylsulfinyl)alkyl]glucosinolic acid (CHEBI:137260) |
| IUPAC Name |
|---|
| 1-S-[7-(methanesulfinyl)-N-(sulfooxy)heptanimidoyl]-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| glucoalissin | MetaCyc |
| Glucohesperalin | HMDB |
| methylsulfinylhexyl-glucosinolate | ChEBI |
| methylsulfinylhexylglucosinolate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C00007348 | KNApSAcK |
| CPDQT-288 | MetaCyc |
| HMDB0038410 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8948953 | Reaxys |
| CAS:33049-17-1 | KNApSAcK |
| Citations |
|---|