EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21NO6S |
| Net Charge | 0 |
| Average Mass | 343.401 |
| Monoisotopic Mass | 343.10896 |
| SMILES | OC[C@H]1O[C@@H](SC(CCc2ccccc2)=NO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C15H21NO6S/c17-8-10-12(18)13(19)14(20)15(22-10)23-11(16-21)7-6-9-4-2-1-3-5-9/h1-5,10,12-15,17-21H,6-8H2/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | HJUSVMWTCVFYOA-LFHLZQBKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | PubMed (27656890) | ||
| - | MetaboLights (MTBLS272) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| desulfogluconasturtiin (CHEBI:136954) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| desulfogluconasturtiin (CHEBI:136954) is a desulfoglucosinolic acid (CHEBI:136442) |
| IUPAC Name |
|---|
| 1-S-(N-hydroxy-3-phenylpropanimidoyl)-1-thio-β-D-glucopyranose |
| Synonyms | Source |
|---|---|
| 2-phenylethyl-desulfoglucosinolate | ChEBI |
| 2-phenylethyldesulfoglucosinolate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18889633 | Reaxys |
| Citations |
|---|