EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO6S |
| Net Charge | 0 |
| Average Mass | 293.341 |
| Monoisotopic Mass | 293.09331 |
| SMILES | C=CCCC(=NO)S[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO6S/c1-2-3-4-7(12-17)19-11-10(16)9(15)8(14)6(5-13)18-11/h2,6,8-11,13-17H,1,3-5H2/t6-,8-,9+,10-,11+/m1/s1 |
| InChIKey | GDASSSSLIRTWJZ-ZHVGPZTNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | PubMed (27656890) | ||
| - | MetaboLights (MTBLS272) | ||
| Brassica napus (ncbitaxon:3708) | seed (BTO:0001226) | Article (CBA:648112) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-butenyldesulfoglucosinolate (CHEBI:136953) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 3-butenyldesulfoglucosinolate (CHEBI:136953) is a desulfoglucosinolic acid (CHEBI:136442) |
| IUPAC Name |
|---|
| 1-S-(N-hydroxypent-4-enimidoyl)-1-thio-β-D-glucopyranose |
| Synonym | Source |
|---|---|
| desulfogluconapin | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18889630 | Reaxys |
| Citations |
|---|