EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:136948 - S-[9-(methylthio)nonylhydroximoyl]-L-cysteine
| Formula | C13H26N2O3S2 |
| Net Charge | 0 |
| Average Mass | 322.496 |
| Monoisotopic Mass | 322.13848 |
| SMILES | CSCCCCCCCCC(=NO)SC[C@H](N)C(=O)O |
| InChI | InChI=1S/C13H26N2O3S2/c1-19-9-7-5-3-2-4-6-8-12(15-18)20-10-11(14)13(16)17/h11,18H,2-10,14H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | OKZTWSCTVDMBGE-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | PubMed (27656890) | ||
| - | MetaboLights (MTBLS272) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-[9-(methylthio)nonylhydroximoyl]-L-cysteine (CHEBI:136948) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| S-[9-(methylthio)nonylhydroximoyl]-L-cysteine (CHEBI:136948) is a N-hydroxyimidothioate (CHEBI:136428) |
| S-[9-(methylthio)nonylhydroximoyl]-L-cysteine (CHEBI:136948) is a S-substituted L-cysteine (CHEBI:47910) |
| S-[9-(methylthio)nonylhydroximoyl]-L-cysteine (CHEBI:136948) is a methyl sulfide (CHEBI:86315) |
| IUPAC Name |
|---|
| S-[N-hydroxy-9-(methylsulfanyl)nonanimidoyl]-L-cysteine |
| Synonyms | Source |
|---|---|
| 9-methylthiononylhydroximoyl-L-cysteine | ChEBI |
| S-[9-(methylthio)nonylhydroximoyl]cysteine | ChEBI |
| S-[9-(methylsufanyl)nonylhydroximoyl]-L-cysteine | ChEBI |
| 9-(methylthio)nonylhydroximoyl-L-cysteine | ChEBI |
| S-[9-(methylsufanyl)nonylhydroximoyl]cysteine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| CPDQT-410 | MetaCyc |