EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H10N2OS |
| Net Charge | 0 |
| Average Mass | 230.292 |
| Monoisotopic Mass | 230.05138 |
| SMILES | COc1ccc2c(-c3nccs3)cnc2c1 |
| InChI | InChI=1S/C12H10N2OS/c1-15-8-2-3-9-10(7-14-11(9)6-8)12-13-4-5-16-12/h2-7,14H,1H3 |
| InChIKey | FGXYYCWDPYDAOS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | PubMed (27656890) | ||
| - | MetaboLights (MTBLS272) |
| Roles Classification |
|---|
| Biological Roles: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. phytoalexin A toxin made by a plant that acts against an organism attacking it. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-methoxycamalexin (CHEBI:136941) has functional parent camalexin (CHEBI:22990) |
| 6-methoxycamalexin (CHEBI:136941) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 6-methoxycamalexin (CHEBI:136941) is a 1,3-thiazoles (CHEBI:38418) |
| 6-methoxycamalexin (CHEBI:136941) is a aromatic ether (CHEBI:35618) |
| 6-methoxycamalexin (CHEBI:136941) is a indole phytoalexin (CHEBI:24797) |
| IUPAC Name |
|---|
| 6-methoxy-3-(1,3-thiazol-2-yl)-1H-indole |
| Synonyms | Source |
|---|---|
| 6-Methoxy-3-(2-thiazolyl)-1H-indole | HMDB |
| 6-methoxy-3-(thiazol-2-yl)indole | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 9335679 | ChemSpider |
| C00036628 | KNApSAcK |
| HMDB0038632 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:135531-87-2 | KNApSAcK |
| Citations |
|---|