EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H31O9 |
| Net Charge | -1 |
| Average Mass | 463.503 |
| Monoisotopic Mass | 463.19736 |
| SMILES | [H][C@@]12CCc3c(ccc(O)c3O[C@@H]3O[C@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]3O)[C@@]1([H])CC[C@]1(C)[C@@H](O)CC[C@@]21[H] |
| InChI | InChI=1S/C24H32O9/c1-24-9-8-11-10-4-6-15(25)20(13(10)3-2-12(11)14(24)5-7-16(24)26)32-23-19(29)17(27)18(28)21(33-23)22(30)31/h4,6,11-12,14,16-19,21,23,25-29H,2-3,5,7-9H2,1H3,(H,30,31)/p-1/t11-,12-,14+,16+,17+,18+,19-,21+,23-,24+/m1/s1 |
| InChIKey | YQYZVYZSWJLJHS-WJXPAFDLSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-17β-estradiol 4-O-(β-D-glucuronide)(1−) (CHEBI:136937) is a monocarboxylic acid anion (CHEBI:35757) |
| 4-hydroxy-17β-estradiol 4-O-(β-D-glucuronide)(1−) (CHEBI:136937) is a steroid glucosiduronic acid anion (CHEBI:136637) |
| 4-hydroxy-17β-estradiol 4-O-(β-D-glucuronide)(1−) (CHEBI:136937) is a β-D-glucosiduronate (CHEBI:83411) |
| 4-hydroxy-17β-estradiol 4-O-(β-D-glucuronide)(1−) (CHEBI:136937) is conjugate base of 4-hydroxy-17β-estradiol 4-O-(β-D-glucuronide) (CHEBI:137917) |
| Incoming Relation(s) |
| 4-hydroxy-17β-estradiol 4-O-(β-D-glucuronide) (CHEBI:137917) is conjugate acid of 4-hydroxy-17β-estradiol 4-O-(β-D-glucuronide)(1−) (CHEBI:136937) |
| IUPAC Name |
|---|
| 3,17β-dihydroxyestra-1(10),2,4-trien-4-yl β-D-glucopyranosiduronate |
| Synonyms | Source |
|---|---|
| (17β)-3,17-dihydroxyestra-1(10),2,4-trien-4-yl β-D-glucopyranosiduronate | IUPAC |
| 4-hydroxy-17β-estradiol 4-glucuronide(1−) | ChEBI |
| 4-hydroxy-17β-estradiol 4-β-glucuronide(1−) | ChEBI |
| 4-hydroxy-17β-estradiol 4-(β-D-glucuronide)(1−) | ChEBI |
| 4-OHE2 4G(1−) | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 17β-estradiol 4-O-(β-D-glucuronate) | UniProt |
| Citations |
|---|