EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H13N2O |
| Net Charge | +1 |
| Average Mass | 177.227 |
| Monoisotopic Mass | 177.10224 |
| SMILES | COc1cccc2ncc(C[NH3+])c12 |
| InChI | InChI=1S/C10H12N2O/c1-13-9-4-2-3-8-10(9)7(5-11)6-12-8/h2-4,6,12H,5,11H2,1H3/p+1 |
| InChIKey | YKDYCKHEKOEVJM-UHFFFAOYSA-O |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS272) | ||
| - | PubMed (27656890) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxy-3-indolylmethylamine(1+) (CHEBI:136935) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 4-methoxy-3-indolylmethylamine(1+) (CHEBI:136935) is a ammonium ion derivative (CHEBI:35274) |
| 4-methoxy-3-indolylmethylamine(1+) (CHEBI:136935) is a organic cation (CHEBI:25697) |
| 4-methoxy-3-indolylmethylamine(1+) (CHEBI:136935) is conjugate acid of 4-methoxy-3-indolylmethylamine (CHEBI:91160) |
| Incoming Relation(s) |
| 4-methoxy-3-indolylmethylamine (CHEBI:91160) is conjugate base of 4-methoxy-3-indolylmethylamine(1+) (CHEBI:136935) |
| IUPAC Name |
|---|
| (4-methoxy-1H-indol-3-yl)methanaminium |
| Manual Xrefs | Databases |
|---|---|
| CPDQT-436 | MetaCyc |