EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H10N2OS |
| Net Charge | 0 |
| Average Mass | 218.281 |
| Monoisotopic Mass | 218.05138 |
| SMILES | COn1cc(CN=C=S)c2ccccc21 |
| InChI | InChI=1S/C11H10N2OS/c1-14-13-7-9(6-12-8-15)10-4-2-3-5-11(10)13/h2-5,7H,6H2,1H3 |
| InChIKey | FLURSKCCKANNKS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | PubMed (27656890) | ||
| - | MetaboLights (MTBLS272) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-(isothiocyanatomethyl)-1-methoxyindole (CHEBI:136932) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 3-(isothiocyanatomethyl)-1-methoxyindole (CHEBI:136932) is a indoles (CHEBI:24828) |
| 3-(isothiocyanatomethyl)-1-methoxyindole (CHEBI:136932) is a isothiocyanate (CHEBI:52221) |
| IUPAC Name |
|---|
| 3-(isothiocyanatomethyl)-1-methoxy-1H-indole |
| Synonyms | Source |
|---|---|
| (1-methoxyindol-3-yl)methyl isothiocyanate | ChEBI |
| 1-methoxyindol-3-ylmethyl isothiocyanate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 10709973 | ChemSpider |
| HMDB0038463 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3549092 | Reaxys |