EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H32O3 |
| Net Charge | 0 |
| Average Mass | 296.451 |
| Monoisotopic Mass | 296.23514 |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCC(O)C(=O)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(19)18(20)21/h6-7,9-10,17,19H,2-5,8,11-16H2,1H3,(H,20,21)/b7-6-,10-9- |
| InChIKey | AFDSETGKYZMEEA-HZJYTTRNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | PubMed (27656890) | ||
| - | MetaboLights (MTBLS272) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | PPARgamma agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-γ. PPARalpha agonist A PPAR modulator which activates the peroxisome proliferator-activated receptor-α. Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxylinoleic acid (CHEBI:136927) has functional parent linoleic acid (CHEBI:17351) |
| 2-hydroxylinoleic acid (CHEBI:136927) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 2-hydroxylinoleic acid (CHEBI:136927) has role antineoplastic agent (CHEBI:35610) |
| 2-hydroxylinoleic acid (CHEBI:136927) has role PPARα agonist (CHEBI:70782) |
| 2-hydroxylinoleic acid (CHEBI:136927) has role PPARγ agonist (CHEBI:71554) |
| 2-hydroxylinoleic acid (CHEBI:136927) is a 2-hydroxy fatty acid (CHEBI:10283) |
| 2-hydroxylinoleic acid (CHEBI:136927) is a HODE (CHEBI:36328) |
| 2-hydroxylinoleic acid (CHEBI:136927) is a long-chain fatty acid (CHEBI:15904) |
| IUPAC Name |
|---|
| (9Z,12Z)-2-hydroxyoctadeca-9,12-dienoic acid |
| Synonyms | Source |
|---|---|
| ABTL-0812 | ChemIDplus |
| alpha-Hydroxylinoleic acid | ChemIDplus |
| ABTL0812 | ChemIDplus |
| 2-hydroxy-9Z,12Z-Octadecadienoic acid | LIPID MAPS |
| α-Hydroxylinoleic acid | LIPID MAPS |
| (9Z,12Z)-2-hydroxyoctadecadienoic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000290 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:27883686 | Reaxys |
| CAS:57818-44-7 | ChemIDplus |
| Citations |
|---|