EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H19NO7S |
| Net Charge | 0 |
| Average Mass | 309.340 |
| Monoisotopic Mass | 309.08822 |
| SMILES | C=C[C@@H](O)CC(=NO)SC1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C11H19NO7S/c1-2-5(14)3-7(12-18)20-11-10(17)9(16)8(15)6(4-13)19-11/h2,5-6,8-11,13-18H,1,3-4H2/t5-,6-,8-,9+,10-,11?/m1/s1 |
| InChIKey | CXWZHRJFLOOOAJ-BDOUVAIHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Arabidopsis thaliana (ncbitaxon:3702) | |||
| - | MetaboLights (MTBLS272) | ||
| - | PubMed (27656890) |
| Roles Classification |
|---|
| Biological Role: | Arabidopsis thaliana metabolite Any plant metabolite that is produced by Arabidopsis thaliana. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-hydroxy-3-butenyldesulfoglucosinolate (CHEBI:136926) has role Arabidopsis thaliana metabolite (CHEBI:140602) |
| 2-hydroxy-3-butenyldesulfoglucosinolate (CHEBI:136926) is a desulfoglucosinolic acid (CHEBI:136442) |
| 2-hydroxy-3-butenyldesulfoglucosinolate (CHEBI:136926) is a secondary allylic alcohol (CHEBI:134396) |
| IUPAC Name |
|---|
| 1-S-[(3S)-N,3-dihydroxypent-4-enimidoyl]-1-thio-D-glucopyranose |