EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H18O2 |
| Net Charge | 0 |
| Average Mass | 350.417 |
| Monoisotopic Mass | 350.13068 |
| SMILES | Oc1ccc(C2(c3ccc(O)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C25H18O2/c26-19-13-9-17(10-14-19)25(18-11-15-20(27)16-12-18)23-7-3-1-5-21(23)22-6-2-4-8-24(22)25/h1-16,26-27H |
| InChIKey | YWFPGFJLYRKYJZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. |
| Application: | anti-estrogen A drug which acts to reduce estrogenic activity in the body, either by reducing the amount of estrogen or by reducing the activity of whatever estrogen is present. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 9,9-bis(4-hydroxyphenyl)fluorene (CHEBI:136855) has role anti-estrogen (CHEBI:50751) |
| 9,9-bis(4-hydroxyphenyl)fluorene (CHEBI:136855) is a fluorenes (CHEBI:24059) |
| 9,9-bis(4-hydroxyphenyl)fluorene (CHEBI:136855) is a polyphenol (CHEBI:26195) |
| IUPAC Name |
|---|
| 4-[9-(4-hydroxyphenyl)-9H-fluoren-9-yl]phenol |
| Synonyms | Source |
|---|---|
| BHPF | ChEBI |
| 9,9-bis(p-hydroxyphenyl)fluorene | ChEBI |
| bisphenol fluorenone | ChemIDplus |
| 4,4'-(9H-fluoren-9-ylidene)bisphenol | ChemIDplus |
| fluorene-9-bisphenol | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2060986 | Reaxys |
| CAS:3236-71-3 | ChemIDplus |
| Citations |
|---|