EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36O4 |
| Net Charge | 0 |
| Average Mass | 400.559 |
| Monoisotopic Mass | 400.26136 |
| SMILES | CC(C)=CCC1=C(O)C(CC=C(C)C)(CC=C(C)C)C(=O)C(C(=O)C(C)C)=C1O |
| InChI | InChI=1S/C25H36O4/c1-15(2)9-10-19-22(27)20(21(26)18(7)8)24(29)25(23(19)28,13-11-16(3)4)14-12-17(5)6/h9,11-12,18,27-28H,10,13-14H2,1-8H3 |
| InChIKey | UNCDMWKTFLUPHZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Humulus lupulus (ncbitaxon:3486) | - | PubMed (18768384) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| colupulone (CHEBI:136851) is a β-bitter acid (CHEBI:136848) |
| colupulone (CHEBI:136851) is conjugate acid of colupulone(1−) (CHEBI:134349) |
| Incoming Relation(s) |
| colupulone(1−) (CHEBI:134349) is conjugate base of colupulone (CHEBI:136851) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-4,6,6-tris(3-methylbut-2-en-1-yl)-2-(2-methylpropanoyl)cyclohexa-2,4-dien-1-one |
| Manual Xrefs | Databases |
|---|---|
| CPD-7111 | MetaCyc |
| HMDB0030065 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2064782 | Reaxys |
| CAS:468-27-9 | ChemIDplus |
| Citations |
|---|