EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C82H107N5O20 |
| Net Charge | 0 |
| Average Mass | 1482.773 |
| Monoisotopic Mass | 1481.75094 |
| SMILES | CC[C@H](C(=O)N1CCCC[C@H]1C(=O)O[C@H](CCc1ccc(OC)c(OC)c1)c1cccc(OCC(=O)NCC(CNC(=O)COc2cccc([C@@H](CCc3ccc(OC)c(OC)c3)OC(=O)[C@@H]3CCCCN3C(=O)[C@@H](CC)c3cc(OC)c(OC)c(OC)c3)c2)CN(C)C)c1)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C82H107N5O20/c1-15-61(57-43-71(98-9)77(102-13)72(44-57)99-10)79(90)86-37-19-17-27-63(86)81(92)106-65(33-29-52-31-35-67(94-5)69(39-52)96-7)55-23-21-25-59(41-55)104-50-75(88)83-47-54(49-85(3)4)48-84-76(89)51-105-60-26-22-24-56(42-60)66(34-30-53-32-36-68(95-6)70(40-53)97-8)107-82(93)64-28-18-20-38-87(64)80(91)62(16-2)58-45-73(100-11)78(103-14)74(46-58)101-12/h21-26,31-32,35-36,39-46,54,61-66H,15-20,27-30,33-34,37-38,47-51H2,1-14H3,(H,83,88)(H,84,89)/t61-,62-,63-,64-,65+,66+/m0/s1 |
| InChIKey | NSBGUMKAXUXKGI-BPNHAYRBSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | ligand Any molecule or ion capable of binding to a central metal atom to form coordination complexes. Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| AP20187 (CHEBI:136847) has role ligand (CHEBI:52214) |
| AP20187 (CHEBI:136847) is a N-acylpiperidine (CHEBI:48591) |
| AP20187 (CHEBI:136847) is a aromatic ether (CHEBI:35618) |
| AP20187 (CHEBI:136847) is a carboxylic ester (CHEBI:33308) |
| AP20187 (CHEBI:136847) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| (1R)-3-(3,4-dimethoxyphenyl)-1-{3-[2-({3-[2-(3-{(1R)-3-(3,4-dimethoxyphenyl)-1-[({(2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidin-2-yl}carbonyl)oxy]propyl}phenoxy)acetamido]-2-[(dimethylamino)methyl]propyl}amino)-2-oxoethoxy]phenyl}propyl (2S)-1-[(2S)-2-(3,4,5-trimethoxyphenyl)butanoyl]piperidine-2-carboxylate |
| Synonyms | Source |
|---|---|
| AP 20187 | ChemIDplus |
| B/B Homodimerizer | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| AP20187 | Wikipedia |
| US6150527 | Patent |
| WO2012103279 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22811386 | Reaxys |
| CAS:195514-80-8 | ChemIDplus |
| Citations |
|---|