EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H36O3 |
| Net Charge | 0 |
| Average Mass | 300.483 |
| Monoisotopic Mass | 300.26645 |
| SMILES | CCCCCCCCCCCCCC(O)CCCC(=O)O |
| InChI | InChI=1S/C18H36O3/c1-2-3-4-5-6-7-8-9-10-11-12-14-17(19)15-13-16-18(20)21/h17,19H,2-16H2,1H3,(H,20,21) |
| InChIKey | YTITYUDOZJUZBE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-hydroxyoctadecanoic acid (CHEBI:136819) is a hydroxyoctadecanoic acid (CHEBI:24747) |
| 5-hydroxyoctadecanoic acid (CHEBI:136819) is conjugate acid of 5-hydroxyoctadecanoate (CHEBI:136370) |
| Incoming Relation(s) |
| 5-[(9Z)-hexadecenoyloxy]octadecanoic acid (CHEBI:137102) has functional parent 5-hydroxyoctadecanoic acid (CHEBI:136819) |
| 5-[(9Z)-octadecenoyloxy]octadecanoic acid (CHEBI:137106) has functional parent 5-hydroxyoctadecanoic acid (CHEBI:136819) |
| 5-hydroxyoctadecanoate (CHEBI:136370) is conjugate base of 5-hydroxyoctadecanoic acid (CHEBI:136819) |
| IUPAC Name |
|---|
| 5-hydroxyoctadecanoic acid |
| Synonyms | Source |
|---|---|
| 5-hydroxystearic acid | ChEBI |
| δ-hydroxystearic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000123 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1790113 | Reaxys |