EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H14N2O7 |
| Net Charge | 0 |
| Average Mass | 262.218 |
| Monoisotopic Mass | 262.08010 |
| SMILES | N[C@@H](CC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O7/c10-4(8(15)16)3-6(12)11-5(9(17)18)1-2-7(13)14/h4-5H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | DBMVITQDGVMXEY-WHFBIAKZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | |||
| blood serum (BTO:0000133) | MetaboLights (MTBLS97) | ||
| blood serum (BTO:0000133) | PubMed (25598764) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | human blood serum metabolite Any metabolite (endogenous or exogenous) found in human blood serum samples. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-Asp-Glu (CHEBI:136817) has role human blood serum metabolite (CHEBI:85234) |
| β-Asp-Glu (CHEBI:136817) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-β-aspartyl-L-glutamic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(3S)-3-amino-3-carboxypropanoyl]amino}pentanedioic acid | IUPAC |
| L-β-Asp-L-Glu | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011164 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1716092 | Reaxys |