EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H36O5 |
| Net Charge | 0 |
| Average Mass | 344.492 |
| Monoisotopic Mass | 344.25627 |
| SMILES | CCCCCCCC(=O)OCC(O)COC(=O)CCCCCCC |
| InChI | InChI=1S/C19H36O5/c1-3-5-7-9-11-13-18(21)23-15-17(20)16-24-19(22)14-12-10-8-6-4-2/h17,20H,3-16H2,1-2H3 |
| InChIKey | DMBAVJVECSKEPF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | MetaboLights (MTBLS312) | ||
| - | PubMed (27500669) |
| Roles Classification |
|---|
| Biological Roles: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| Application: | excipient A generally pharmacologically inactive substance that is formulated with the active ingredient of a medication. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3-dioctanoylglycerol (CHEBI:136814) has functional parent octanoic acid (CHEBI:28837) |
| 1,3-dioctanoylglycerol (CHEBI:136814) has role Brassica napus metabolite (CHEBI:140165) |
| 1,3-dioctanoylglycerol (CHEBI:136814) has role excipient (CHEBI:75324) |
| 1,3-dioctanoylglycerol (CHEBI:136814) is a 1,3-diglyceride (CHEBI:47777) |
| IUPAC Name |
|---|
| 2-hydroxypropane-1,3-diyl dioctanoate |
| Synonyms | Source |
|---|---|
| 1,3-Dicapryloylglycerol | ChemIDplus |
| 1,3-dicaprylin | ChEBI |
| DAG(8:0/0:0/8:0) | HMDB |
| DG(8:0/0:0/8:0) | HMDB |
| diacylglycerol (8:0/0:0/8:0) | HMDB |
| Manual Xrefs | Databases |
|---|---|
| HMDB0092900 | HMDB |
| CPD0-1815 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1801556 | Reaxys |
| CAS:1429-66-9 | ChemIDplus |
| Citations |
|---|