EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H12O8 |
| Net Charge | 0 |
| Average Mass | 344.275 |
| Monoisotopic Mass | 344.05322 |
| SMILES | COc1cc2c(=O)oc3c(OC)c(O)cc4c(=O)oc(c1OC)c2c34 |
| InChI | InChI=1S/C17H12O8/c1-21-9-5-7-11-10-6(16(19)25-15(11)13(9)23-3)4-8(18)12(22-2)14(10)24-17(7)20/h4-5,18H,1-3H3 |
| InChIKey | LXEQIOGTMDLLEC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,3'-Tri-O-methylellagic acid (CHEBI:1368) is a tannin (CHEBI:26848) |
| Synonym | Source |
|---|---|
| 3,4,3'-Tri-O-methylellagic acid | KEGG COMPOUND |