EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H26N2O5S |
| Net Charge | 0 |
| Average Mass | 334.438 |
| Monoisotopic Mass | 334.15624 |
| SMILES | CCCCCC(O)C(CC=O)SCC(N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C14H26N2O5S/c1-2-3-4-5-11(18)12(6-7-17)22-9-10(15)14(21)16-8-13(19)20/h7,10-12,18H,2-6,8-9,15H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | LQTWZQSULMRBEE-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | MetaboLights (MTBLS312) | ||
| - | PubMed (27500669) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-(4-hydroxy-1-oxononan-3-yl)cysteinylglycine (CHEBI:136777) has role Brassica napus metabolite (CHEBI:140165) |
| S-(4-hydroxy-1-oxononan-3-yl)cysteinylglycine (CHEBI:136777) is a aliphatic sulfide (CHEBI:22327) |
| S-(4-hydroxy-1-oxononan-3-yl)cysteinylglycine (CHEBI:136777) is a dipeptide (CHEBI:46761) |
| S-(4-hydroxy-1-oxononan-3-yl)cysteinylglycine (CHEBI:136777) is a hydroxyaldehyde (CHEBI:50413) |
| S-(4-hydroxy-1-oxononan-3-yl)cysteinylglycine (CHEBI:136777) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| S-(4-hydroxy-1-oxononan-3-yl)cysteinylglycine |
| Synonym | Source |
|---|---|
| 4-hydroxy-2-nonenal-Cys-Gly conjugate | ChEBI |