EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H42O |
| Net Charge | 0 |
| Average Mass | 382.632 |
| Monoisotopic Mass | 382.32357 |
| SMILES | [H][C@@]12CCC3=C(CC[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC=C3CC3)[C@@]1(C)CC[C@H](O)C2 |
| InChI | InChI=1S/C27H42O/c1-18(5-4-6-19-7-8-19)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,2)25(22)14-16-27(23,24)3/h6,18,20-21,23-24,28H,4-5,7-17H2,1-3H3/t18-,20+,21+,23-,24+,26+,27-/m1/s1 |
| InChIKey | PARCYOHVCUKSCA-BJDKXSRUSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | MetaboLights (MTBLS312) | ||
| - | PubMed (27500669) |
| Roles Classification |
|---|
| Biological Roles: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). sterol methyltransferase inhibitor An EC 2.1.1.* (methyltransferases) inhibitor that interferes with the action of sterol methyltransferase. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 26,27-dehydrozymosterol (CHEBI:136770) has functional parent zymosterol (CHEBI:18252) |
| 26,27-dehydrozymosterol (CHEBI:136770) has parent hydride 5α-cholestane (CHEBI:35515) |
| 26,27-dehydrozymosterol (CHEBI:136770) has role Brassica napus metabolite (CHEBI:140165) |
| 26,27-dehydrozymosterol (CHEBI:136770) has role sterol methyltransferase inhibitor (CHEBI:52303) |
| 26,27-dehydrozymosterol (CHEBI:136770) is a 3β-sterol (CHEBI:35348) |
| 26,27-dehydrozymosterol (CHEBI:136770) is a cholestanoid (CHEBI:50401) |
| 26,27-dehydrozymosterol (CHEBI:136770) is a cyclopropanes (CHEBI:51454) |
| IUPAC Name |
|---|
| 26,27-cyclo-5α-cholesta-8,24-dien-3β-ol |
| Synonyms | Source |
|---|---|
| 26,27-cyclozymosterol | ChEBI |
| 26,27-DHZ | ChEBI |
| (3β,5α)-26,27-cyclocholesta-8,24-dien-3-ol | IUPAC |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22059067 | Reaxys |
| Citations |
|---|