EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H48O6S |
| Net Charge | 0 |
| Average Mass | 512.753 |
| Monoisotopic Mass | 512.31716 |
| SMILES | [H][C@@]12CC(=O)[C@@]3([H])C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@@]1(C)[C@@]2([H])CC[C@]1([H])[C@H](C)[C@H](C[C@H](C)C(C)C)OS(=O)(=O)O |
| InChI | InChI=1S/C28H48O6S/c1-16(2)17(3)13-26(34-35(31,32)33)18(4)21-7-8-22-20-15-25(30)24-14-19(29)9-11-28(24,6)23(20)10-12-27(21,22)5/h16-24,26,29H,7-15H2,1-6H3,(H,31,32,33)/t17-,18-,19-,20-,21+,22-,23-,24+,26-,27+,28+/m0/s1 |
| InChIKey | MMHKTOGFTDNQOU-QDUMAPLTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | PubMed (27500669) | ||
| - | MetaboLights (MTBLS312) |
| Roles Classification |
|---|
| Biological Role: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 24-epi-cathasterone-22-O-sulfate (CHEBI:136768) has role Brassica napus metabolite (CHEBI:140165) |
| 24-epi-cathasterone-22-O-sulfate (CHEBI:136768) is a 3α-hydroxy steroid (CHEBI:36835) |
| 24-epi-cathasterone-22-O-sulfate (CHEBI:136768) is a 6-oxo steroid (CHEBI:36883) |
| 24-epi-cathasterone-22-O-sulfate (CHEBI:136768) is a brassinosteroid (CHEBI:22921) |
| 24-epi-cathasterone-22-O-sulfate (CHEBI:136768) is a steroid sulfate (CHEBI:16158) |
| IUPAC Name |
|---|
| (22S)-3β-hydroxy-6-oxo-5α-ergostan-22-yl hydrogen sulfate |
| Synonyms | Source |
|---|---|
| 24-epi-cathasterone-22-sulfate | ChEBI |
| 24-epicathasterone-22-O-sulfate | ChEBI |
| (3β,5α,22S)-3-hydroxy-6-oxoergostan-22-yl hydrogen sulfate | IUPAC |