EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H8O9P |
| Net Charge | -3 |
| Average Mass | 243.084 |
| Monoisotopic Mass | 242.99224 |
| SMILES | O=C([O-])[C@H](O)[C@@H](O)[C@@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C5H11O9P/c6-2(1-14-15(11,12)13)3(7)4(8)5(9)10/h2-4,6-8H,1H2,(H,9,10)(H2,11,12,13)/p-3/t2-,3-,4+/m0/s1 |
| InChIKey | HNECGPFIYSOYHF-YVZJFKFKSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-phospho-L-arabinonate(3−) (CHEBI:136756) is a 4-hydroxy monocarboxylic acid anion (CHEBI:136596) |
| 5-phospho-L-arabinonate(3−) (CHEBI:136756) is a organophosphate oxoanion (CHEBI:58945) |
| 5-phospho-L-arabinonate(3−) (CHEBI:136756) is conjugate base of 5-phospho-L-arabinonic acid (CHEBI:136754) |
| Incoming Relation(s) |
| 5-phospho-L-arabinonic acid (CHEBI:136754) is conjugate acid of 5-phospho-L-arabinonate(3−) (CHEBI:136756) |
| IUPAC Name |
|---|
| 5-O-phosphonato-L-arabinonate |
| UniProt Name | Source |
|---|---|
| 5-phospho-L-arabinonate | UniProt |
| Citations |
|---|