EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H36F3N5O10 |
| Net Charge | 0 |
| Average Mass | 719.670 |
| Monoisotopic Mass | 719.24143 |
| SMILES | CC(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)Nc1ccc2c(C(F)(F)F)cc(=O)oc2c1)C(C)C |
| InChI | InChI=1S/C33H36F3N5O10/c1-15(2)28(41-31(49)23(38-17(4)42)11-18-5-8-20(43)9-6-18)32(50)37-16(3)29(47)40-24(14-26(44)45)30(48)39-19-7-10-21-22(33(34,35)36)13-27(46)51-25(21)12-19/h5-10,12-13,15-16,23-24,28,43H,11,14H2,1-4H3,(H,37,50)(H,38,42)(H,39,48)(H,40,47)(H,41,49)(H,44,45)/t16-,23-,24-,28-/m0/s1 |
| InChIKey | GWKJISJKNKIJNP-DEQDFGQZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | protease inhibitor A compound which inhibits or antagonizes the biosynthesis or actions of proteases (endopeptidases). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ac-Tyr-Val-Ala-Asp-7-amino-4-trifluoromethylcoumarin (CHEBI:136755) has functional parent 7-amino-4-(trifluoromethyl)coumarin (CHEBI:51772) |
| Ac-Tyr-Val-Ala-Asp-7-amino-4-trifluoromethylcoumarin (CHEBI:136755) has role protease inhibitor (CHEBI:37670) |
| Ac-Tyr-Val-Ala-Asp-7-amino-4-trifluoromethylcoumarin (CHEBI:136755) is a acetamides (CHEBI:22160) |
| Ac-Tyr-Val-Ala-Asp-7-amino-4-trifluoromethylcoumarin (CHEBI:136755) is a coumarins (CHEBI:23403) |
| Ac-Tyr-Val-Ala-Asp-7-amino-4-trifluoromethylcoumarin (CHEBI:136755) is a organofluorine compound (CHEBI:37143) |
| Ac-Tyr-Val-Ala-Asp-7-amino-4-trifluoromethylcoumarin (CHEBI:136755) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| N-acetyl-L-tyrosyl-L-valyl-L-alanyl-N-[2-oxo-4-(trifluoromethyl)-2H-1-benzopyran-7-yl]-L-α-asparagine |
| Synonyms | Source |
|---|---|
| Ac-L-Tyr-L-Val-L-Ala-L-Asp-AFC | ChEBI |
| Ac-Tyr-Val-Ala-Asp-AFC | ChEBI |
| Ac-YVAD-AFC | ChEBI |