EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H19ClF3NO5 |
| Net Charge | 0 |
| Average Mass | 433.810 |
| Monoisotopic Mass | 433.09039 |
| SMILES | CCOCCOC(=O)[C@@H](C)Oc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| InChI | InChI=1S/C19H19ClF3NO5/c1-3-26-8-9-27-18(25)12(2)28-14-4-6-15(7-5-14)29-17-16(20)10-13(11-24-17)19(21,22)23/h4-7,10-12H,3,8-9H2,1-2H3/t12-/m1/s1 |
| InChIKey | MIJLZGZLQLAQCM-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Application: | proherbicide A compound that, on administration, must undergo chemical conversion by biochemical (enzymatic), chemical (possibly following an enzymatic step), or physical (e.g. photochemical) activation processes before becoming the pharmacologically active herbicide for which it is a proherbicide. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| haloxyfop-P-etotyl (CHEBI:136737) has role proherbicide (CHEBI:136646) |
| haloxyfop-P-etotyl (CHEBI:136737) is a 2-ethoxyethyl 2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate (CHEBI:136736) |
| haloxyfop-P-etotyl (CHEBI:136737) is enantiomer of (S)-haloxyfop-etotyl (CHEBI:136738) |
| Incoming Relation(s) |
| haloxyfop-etotyl (CHEBI:136739) has part haloxyfop-P-etotyl (CHEBI:136737) |
| (S)-haloxyfop-etotyl (CHEBI:136738) is enantiomer of haloxyfop-P-etotyl (CHEBI:136737) |
| IUPAC Name |
|---|
| 2-ethoxyethyl (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propanoate |
| Synonym | Source |
|---|---|
| 2-ethoxyethyl (2R)-2-(4-{[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}phenoxy)propionate | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| derivatives/haloxyfop-p-etotyl | Alan Wood's Pesticides |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10713655 | Reaxys |
| Citations |
|---|