EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H27NO4 |
| Net Charge | 0 |
| Average Mass | 357.450 |
| Monoisotopic Mass | 357.19401 |
| SMILES | COc1ccc(C[C@@H]2c3cc(OC)c(OC)cc3CCN2C)cc1OC |
| InChI | InChI=1S/C21H27NO4/c1-22-9-8-15-12-20(25-4)21(26-5)13-16(15)17(22)10-14-6-7-18(23-2)19(11-14)24-3/h6-7,11-13,17H,8-10H2,1-5H3/t17-/m1/s1 |
| InChIKey | KGPAYJZAMGEDIQ-QGZVFWFLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (R)-laudanosine (CHEBI:136734) has functional parent (R)-tetrahydropapaverine (CHEBI:136735) |
| (R)-laudanosine (CHEBI:136734) is a aromatic ether (CHEBI:35618) |
| (R)-laudanosine (CHEBI:136734) is a benzylisoquinoline alkaloid (CHEBI:22750) |
| (R)-laudanosine (CHEBI:136734) is a benzyltetrahydroisoquinoline (CHEBI:26901) |
| (R)-laudanosine (CHEBI:136734) is a polyether (CHEBI:46774) |
| (R)-laudanosine (CHEBI:136734) is a tertiary amino compound (CHEBI:50996) |
| (R)-laudanosine (CHEBI:136734) is conjugate base of (R)-laudanosine(1+) (CHEBI:134210) |
| Incoming Relation(s) |
| (R)-laudanosine(1+) (CHEBI:134210) is conjugate acid of (R)-laudanosine (CHEBI:136734) |
| IUPAC Name |
|---|
| (1R)-1-[(3,4-dimethoxyphenyl)methyl]-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinoline |
| Synonyms | Source |
|---|---|
| (R)-N-methyltetrahydropapaverine | ChEBI |
| (R)-(−)-laudanosine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:96753 | Reaxys |
| Citations |
|---|