EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H40O5 |
| Net Charge | 0 |
| Average Mass | 408.579 |
| Monoisotopic Mass | 408.28757 |
| SMILES | [H][C@]12CC[C@]3([H])[C@]([H])(C[C@H](O)[C@@]4(C)[C@@]3([H])CC[C@]4([H])[C@H](C)CCC(=O)O)[C@@]1(C)[C@H](O)C[C@@H](O)C2 |
| InChI | InChI=1S/C24H40O5/c1-13(4-9-22(28)29)17-7-8-18-16-6-5-14-10-15(25)11-20(26)23(14,2)19(16)12-21(27)24(17,18)3/h13-21,25-27H,4-12H2,1-3H3,(H,28,29)/t13-,14-,15+,16+,17-,18+,19+,20-,21+,23+,24-/m1/s1 |
| InChIKey | DAKYVYUAVGJDRK-FPUZENINSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo Sapiens (ncbitaxon:9606) | urine (BTO:0001419) | PubMed (27402728) |
| Roles Classification |
|---|
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. bile acid metabolite Metabolites of bile acids, four-ringed steroid acids formed along the cholesterol degradation pathway. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1β-hydroxydeoxycholic acid (CHEBI:136724) has role bile acid metabolite (CHEBI:48887) |
| 1β-hydroxydeoxycholic acid (CHEBI:136724) has role human urinary metabolite (CHEBI:84087) |
| 1β-hydroxydeoxycholic acid (CHEBI:136724) is a 1-hydroxy steroid (CHEBI:71017) |
| 1β-hydroxydeoxycholic acid (CHEBI:136724) is a 12α-hydroxy steroid (CHEBI:36846) |
| 1β-hydroxydeoxycholic acid (CHEBI:136724) is a 3β-hydroxy steroid (CHEBI:36836) |
| 1β-hydroxydeoxycholic acid (CHEBI:136724) is a trihydroxy-5β-cholanic acid (CHEBI:27114) |
| IUPAC Name |
|---|
| 1β,3α,12α-trihydroxy-5β-cholan-24-oic acid |
| Synonyms | Source |
|---|---|
| (1β,3α,5β,12α)-1,3,12-trihydroxycholan-24-oic acid | IUPAC |
| 1beta-Hydroxydeoxycholic acid | ChemIDplus |
| 1beta,3alpha,12alpha-Trihydroxy-5beta-cholan-24-oic acid | ChemIDplus |
| 1beta,3alpha,2alpha-Trihydroxy-5beta-cholanoic acid | ChemIDplus |
| 1β-OH-deoxycholic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5768876 | Reaxys |
| CAS:80434-32-8 | ChemIDplus |
| Citations |
|---|