EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H41NO5 |
| Net Charge | 0 |
| Average Mass | 411.583 |
| Monoisotopic Mass | 411.29847 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C23H41NO5/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(25)24-20(23(28)29)18-19-22(26)27/h9-10,20H,2-8,11-19H2,1H3,(H,24,25)(H,26,27)(H,28,29)/b10-9-/t20-/m0/s1 |
| InChIKey | UUFVSGRELDGPGL-QJRAZLAKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyl-L-glutamic acid (CHEBI:136713) has functional parent oleic acid (CHEBI:16196) |
| N-oleoyl-L-glutamic acid (CHEBI:136713) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-oleoyl-L-glutamic acid (CHEBI:136713) is a N-acyl-L-glutamic acid (CHEBI:21650) |
| N-oleoyl-L-glutamic acid (CHEBI:136713) is conjugate acid of N-oleoyl-L-glutamate(2−) (CHEBI:134122) |
| Incoming Relation(s) |
| N-oleoyl-L-glutamate(2−) (CHEBI:134122) is conjugate base of N-oleoyl-L-glutamic acid (CHEBI:136713) |
| IUPAC Name |
|---|
| N-[(9Z)-octadec-9-enoyl]-L-glutamic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(9Z)-octadec-9-enoyl]amino}pentanedioic acid | ChEBI |
| N-(9Z-octadecenoyl)glutamic acid | ChEBI |
| N-[(9Z)-octadecenoyl]glutamic acid | ChEBI |
| N-(9Z-octadecenoyl)-L-glutamic acid | ChEBI |
| N-[(9Z)-octadecenoyl]-L-glutamic acid | ChEBI |
| N-oleoylglutamic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020088 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1717063 | Reaxys |
| CAS:4627-61-6 | ChemIDplus |
| Citations |
|---|