EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H45NO3 |
| Net Charge | 0 |
| Average Mass | 395.628 |
| Monoisotopic Mass | 395.33994 |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)N[C@H](C(=O)O)[C@@H](C)CC |
| InChI | InChI=1S/C24H45NO3/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-22(26)25-23(24(27)28)21(3)5-2/h12-13,21,23H,4-11,14-20H2,1-3H3,(H,25,26)(H,27,28)/b13-12-/t21-,23-/m0/s1 |
| InChIKey | TYWACVZIFBZIQZ-BSFUXZNJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-oleoyl-L-isoleucine (CHEBI:136711) has functional parent oleic acid (CHEBI:16196) |
| N-oleoyl-L-isoleucine (CHEBI:136711) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-oleoyl-L-isoleucine (CHEBI:136711) is a L-isoleucine derivative (CHEBI:84111) |
| N-oleoyl-L-isoleucine (CHEBI:136711) is conjugate acid of N-oleoyl-L-isoleucinate (CHEBI:134121) |
| Incoming Relation(s) |
| N-oleoyl-L-isoleucinate (CHEBI:134121) is conjugate base of N-oleoyl-L-isoleucine (CHEBI:136711) |
| IUPAC Name |
|---|
| N-[(9Z)-octadec-9-enoyl]-L-isoleucine |
| Synonyms | Source |
|---|---|
| (2S,3S)-3-methyl-2-{[(9Z)-octadec-9-enoyl]amino}pentanoic acid | IUPAC |
| N-(9Z-octadecenoyl)isoleucine | ChEBI |
| N-[(9Z)-octadecenoyl]isoleucine | ChEBI |
| N-(9Z-octadecenoyl)-L-isoleucine | ChEBI |
| N-[(9Z)-octadecenoyl]-L-isoleucine | ChEBI |
| N-oleoylisoleucine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020113 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20745805 | Reaxys |