EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H24N2O8 |
| Net Charge | 0 |
| Average Mass | 384.385 |
| Monoisotopic Mass | 384.15327 |
| SMILES | CC(=O)N[C@H]1[C@@H](Oc2ccc(C[C@H](N)C(=O)O)cc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H24N2O8/c1-8(21)19-13-15(23)14(22)12(7-20)27-17(13)26-10-4-2-9(3-5-10)6-11(18)16(24)25/h2-5,11-15,17,20,22-23H,6-7,18H2,1H3,(H,19,21)(H,24,25)/t11-,12+,13+,14+,15+,17-/m0/s1 |
| InChIKey | MHAGZPXTGMUHCQ-CXECBNLGSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-acetyl-α-D-glucosaminyl-L-tyrosine (CHEBI:136688) is a O4'-glycosyl-L-tyrosine (CHEBI:21990) |
| Incoming Relation(s) |
| N-acetyl-α-D-glucosaminyl-L-tyrosyl residue (CHEBI:134208) is substituent group from N-acetyl-α-D-glucosaminyl-L-tyrosine (CHEBI:136688) |
| IUPAC Name |
|---|
| O-(3-acetamido-3-deoxy-α-D-glucopyranosyl)-L-tyrosine |
| Synonyms | Source |
|---|---|
| N-acetyl-α-D-glucosaminyltyrosine | ChEBI |
| O4'-(N-acetyl-α-D-glucosaminyl)-L-tyrosine | ChEBI |
| O4'-(N-acetyl-α-D-glucosaminyl)tyrosine | ChEBI |