EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H43NO3 |
| Net Charge | 0 |
| Average Mass | 417.634 |
| Monoisotopic Mass | 417.32429 |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)N[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C26H43NO3/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25(28)27-24(26(29)30)22-23(2)3/h8-9,11-12,14-15,17-18,23-24H,4-7,10,13,16,19-22H2,1-3H3,(H,27,28)(H,29,30)/b9-8-,12-11-,15-14-,18-17-/t24-/m0/s1 |
| InChIKey | WNCPUJGFGSAQTQ-FBDUAZINSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-arachidonoyl-L-leucine (CHEBI:136683) has functional parent arachidonic acid (CHEBI:15843) |
| N-arachidonoyl-L-leucine (CHEBI:136683) is a N-(fatty acyl)-L-α-amino acid (CHEBI:137550) |
| N-arachidonoyl-L-leucine (CHEBI:136683) is a L-leucine derivative (CHEBI:25018) |
| N-arachidonoyl-L-leucine (CHEBI:136683) is conjugate acid of N-arachidonoyl-L-leucinate (CHEBI:134103) |
| Incoming Relation(s) |
| N-arachidonoyl-L-leucinate (CHEBI:134103) is conjugate base of N-arachidonoyl-L-leucine (CHEBI:136683) |
| IUPAC Name |
|---|
| N-[(5Z,8Z,11Z,14Z)-icosa-5,8,11,14-tetraenoyl]-L-leucine |
| Synonyms | Source |
|---|---|
| N-[(5Z,8Z,11Z,14Z)-eicosatetraenoyl]leucine | ChEBI |
| N-(5Z,8Z,11Z,14Z-eicosatetraenoyl)-L-leucine | ChEBI |
| N-[(5Z,8Z,11Z,14Z)-eicosatetraenoyl]-L-leucine | ChEBI |
| N-[(5Z,8Z,11Z,14Z)-icosatetraenoyl]leucine | ChEBI |
| N-(5Z,8Z,11Z,14Z-icosatetraenoyl)-L-leucine | ChEBI |
| N-[(5Z,8Z,11Z,14Z)-icosatetraenoyl]-L-leucine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMFA08020114 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:25442003 | Reaxys |
| Citations |
|---|