EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H13NO2S |
| Net Charge | 0 |
| Average Mass | 163.242 |
| Monoisotopic Mass | 163.06670 |
| SMILES | CSCC[C@H](N)CC(=O)O |
| InChI | InChI=1S/C6H13NO2S/c1-10-3-2-5(7)4-6(8)9/h5H,2-4,7H2,1H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | QWVNCDVONVDGDV-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | PubMed (26641455) | ||
| - | MetaboLights (MTBLS309) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-β-homomethionine (CHEBI:136681) has role Brassica napus metabolite (CHEBI:140165) |
| L-β-homomethionine (CHEBI:136681) is a methyl sulfide (CHEBI:86315) |
| L-β-homomethionine (CHEBI:136681) is a β-amino acid (CHEBI:33706) |
| IUPAC Name |
|---|
| (3R)-3-amino-5-(methylsulfanyl)pentanoic acid |
| Synonym | Source |
|---|---|
| β-L-homomethionine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 22906168 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4370321 | Reaxys |