EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H10N4O2 |
| Net Charge | 0 |
| Average Mass | 146.150 |
| Monoisotopic Mass | 146.08038 |
| SMILES | N=C(N)NC[C@H](N)C(=O)O |
| InChI | InChI=1S/C4H10N4O2/c5-2(3(9)10)1-8-4(6)7/h2H,1,5H2,(H,9,10)(H4,6,7,8)/t2-/m0/s1 |
| InChIKey | XNBJHKABANTVCP-REOHCLBHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| β-guanidino-L-alanine (CHEBI:136680) has role Brassica napus metabolite (CHEBI:140165) |
| β-guanidino-L-alanine (CHEBI:136680) is a L-alanine derivative (CHEBI:83943) |
| β-guanidino-L-alanine (CHEBI:136680) is a guanidines (CHEBI:24436) |
| β-guanidino-L-alanine (CHEBI:136680) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| IUPAC Name |
|---|
| 3-carbamimidamido-L-alanine |
| Synonyms | Source |
|---|---|
| L-2-amino-3-guanidinopropionic acid | ChEBI |
| 3-((Aminoiminomethyl)amino)-L-alanine | ChemIDplus |
| 3-guanidino-L-alanine | ChEBI |
| L-α-amino-β-guanidinopropionic acid | ChEBI |
| dinor-L-arginine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2413421 | Reaxys |
| CAS:14191-91-4 | ChemIDplus |
| Citations |
|---|