EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:136666 - eupatorin
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)cc1O |
| InChI | InChI=1S/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
| InChIKey | KLAOKWJLUQKWIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Brassica napus (ncbitaxon:3708) | |||
| - | PubMed (26641455) | ||
| - | MetaboLights (MTBLS309) | ||
| Orthosiphon stamineus (ncbitaxon:260636) | leaf (BTO:0000713) | PubMed (27695261) | |
| Artemisia incisa (ncbitaxon:1177119) | aerial part (BTO:0001658) | PubMed (27187805) | |
| Salvia connivens (ncbitaxon:2026474) | - | PubMed (28347190) | |
| Veronica orchidea (ncbitaxon:996481) | aerial part (BTO:0001658) | PubMed (26404257) | |
| Achillea alpina (ncbitaxon:282718) | aerial part (BTO:0001658) | PubMed (26281557) | |
| Veronica officinalis (ncbitaxon:160511) | aerial part (BTO:0001658) | PubMed (26404257) | |
| Merrillia caloxylon (ncbitaxon:159055) | - | PubMed (905420) | |
| Salvia plebeia (ncbitaxon:424424) | - | PubMed (24422962) | |
| Croton ciliatoglandulifer (ncbitaxon:323039) | - | PubMed (26322527) | |
| Salvia filipes (ncbitaxon:2026484) | aerial part (BTO:0001658) | PubMed (27679866) | |
| Veronica austriaca subsp. teucrium (ncbitaxon:1483217) | aerial part (BTO:0001658) | PubMed (26404257) | |
| Centaurea virgata (ncbitaxon:124936) | - | PubMed (27991400) | |
| Eupatorium semiserratum (ncbitaxon:103755) | - | PubMed (5847037) |
| Roles Classification |
|---|
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. anti-inflammatory agent Any compound that has anti-inflammatory effects. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eupatorin (CHEBI:136666) has functional parent 6-hydroxyluteolin (CHEBI:2197) |
| eupatorin (CHEBI:136666) has role Brassica napus metabolite (CHEBI:140165) |
| eupatorin (CHEBI:136666) has role anti-inflammatory agent (CHEBI:67079) |
| eupatorin (CHEBI:136666) has role antineoplastic agent (CHEBI:35610) |
| eupatorin (CHEBI:136666) has role apoptosis inducer (CHEBI:68495) |
| eupatorin (CHEBI:136666) has role calcium channel blocker (CHEBI:38215) |
| eupatorin (CHEBI:136666) has role P450 inhibitor (CHEBI:50183) |
| eupatorin (CHEBI:136666) has role vasodilator agent (CHEBI:35620) |
| eupatorin (CHEBI:136666) is a dihydroxyflavone (CHEBI:38686) |
| eupatorin (CHEBI:136666) is a polyphenol (CHEBI:26195) |
| eupatorin (CHEBI:136666) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 3',5-Dihydroxy-4',6,7-trimethoxyflavone | KNApSAcK |
| Eupatorine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| eupatorin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 87743 | ChemSpider |
| C00003894 | KNApSAcK |
| LMPK12111239 | LIPID MAPS |
| Citations |
|---|