EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H16O7 |
| Net Charge | 0 |
| Average Mass | 344.319 |
| Monoisotopic Mass | 344.08960 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(OC)c(OC)cc3o2)cc1O |
| InChI | InChI=1S/C18H16O7/c1-22-12-5-4-9(6-10(12)19)13-7-11(20)16-14(25-13)8-15(23-2)18(24-3)17(16)21/h4-8,19,21H,1-3H3 |
| InChIKey | KLAOKWJLUQKWIF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Achillea alpina (ncbitaxon:282718) | aerial part (BTO:0001658) | PubMed (26281557) | |
| Artemisia incisa (ncbitaxon:1177119) | aerial part (BTO:0001658) | PubMed (27187805) | |
| Brassica napus (ncbitaxon:3708) | |||
| - | MetaboLights (MTBLS309) | ||
| - | PubMed (26641455) | ||
| Centaurea virgata (ncbitaxon:124936) | - | PubMed (27991400) | |
| Croton ciliatoglandulifer (ncbitaxon:323039) | - | PubMed (26322527) | |
| Eupatorium semiserratum (ncbitaxon:103755) | - | PubMed (5847037) | |
| Merrillia caloxylon (ncbitaxon:159055) | - | PubMed (905420) | |
| Orthosiphon stamineus (ncbitaxon:260636) | leaf (BTO:0000713) | PubMed (27695261) | |
| Salvia connivens (ncbitaxon:2026474) | - | PubMed (28347190) | |
| Salvia filipes (ncbitaxon:2026484) | aerial part (BTO:0001658) | PubMed (27679866) | |
| Salvia plebeia (ncbitaxon:424424) | - | PubMed (24422962) | |
| Veronica austriaca subsp. teucrium (ncbitaxon:1483217) | aerial part (BTO:0001658) | PubMed (26404257) | |
| Veronica officinalis (ncbitaxon:160511) | aerial part (BTO:0001658) | PubMed (26404257) | |
| Veronica orchidea (ncbitaxon:996481) | aerial part (BTO:0001658) | PubMed (26404257) |
| Roles Classification |
|---|
| Biological Roles: | P450 inhibitor An enzyme inhibitor that interferes with the activity of cytochrome P450 involved in catalysis of organic substances. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. calcium channel blocker One of a class of drugs that acts by selective inhibition of calcium influx through cell membranes or on the release and binding of calcium in intracellular pools. Brassica napus metabolite Any plant metabolite that is produced by rapeseed (Brassica napus). |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. vasodilator agent A drug used to cause dilation of the blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eupatorin (CHEBI:136666) has functional parent 6-hydroxyluteolin (CHEBI:2197) |
| eupatorin (CHEBI:136666) has role Brassica napus metabolite (CHEBI:140165) |
| eupatorin (CHEBI:136666) has role anti-inflammatory agent (CHEBI:67079) |
| eupatorin (CHEBI:136666) has role antineoplastic agent (CHEBI:35610) |
| eupatorin (CHEBI:136666) has role apoptosis inducer (CHEBI:68495) |
| eupatorin (CHEBI:136666) has role calcium channel blocker (CHEBI:38215) |
| eupatorin (CHEBI:136666) has role P450 inhibitor (CHEBI:50183) |
| eupatorin (CHEBI:136666) has role vasodilator agent (CHEBI:35620) |
| eupatorin (CHEBI:136666) is a dihydroxyflavone (CHEBI:38686) |
| eupatorin (CHEBI:136666) is a polyphenol (CHEBI:26195) |
| eupatorin (CHEBI:136666) is a trimethoxyflavone (CHEBI:27124) |
| IUPAC Name |
|---|
| 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,7-dimethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 3',5-Dihydroxy-4',6,7-trimethoxyflavone | KNApSAcK |
| Eupatorine | ChemIDplus |
| UniProt Name | Source |
|---|---|
| eupatorin | UniProt |
| Manual Xrefs | Databases |
|---|---|
| 87743 | ChemSpider |
| C00003894 | KNApSAcK |
| LMPK12111239 | LIPID MAPS |
| Citations |
|---|